C23H11Cl2O4- — CID 59705932
6-chloro-2-[(1E,3E,5Z)-5-(5-chloro-1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxoinden-1-olate (PubChem CID 59705932) has the molecular formula C23H11Cl2O4- and a molecular weight of 422.24 g/mol. Its IUPAC name is 6-chloro-2-[(1E,3E,5Z)-5-(5-chloro-1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxoinden-1-olate.
| Compound Name | 6-chloro-2-[(1E,3E,5Z)-5-(5-chloro-1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxoinden-1-olate |
|---|---|
| PubChem CID | 59705932 |
| Molecular Formula | C23H11Cl2O4- |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 6-chloro-2-[(1E,3E,5Z)-5-(5-chloro-1,3-dioxoinden-2-ylidene)penta-1,3-dienyl]-3-oxoinden-1-olate |
| SMILES | O=C1C(/C=C/C=C/C=C2/C(=O)c3ccc(Cl)cc3C2=O)=C([O-])c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H12Cl2O4/c24-12-6-8-14-18(10-12)22(28)16(20(14)26)4-2-1-3-5-17-21(27)15-9-7-13(25)11-19(15)23(17)29/h1-11,28H/p-1/b3-1+,4-2+,17-5- |
| InChIKey | NOQJSUQEKZHTSZ-WGUILMMDSA-M |
| XLogP | 4.38 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|