C23H19F5N2O — CID 59705964
3-N,3-N,6-N,6-N-tetramethyl-9-(2,3,4,5,6-pentafluorophenyl)-9H-xanthene-3,6-diamine (PubChem CID 59705964) has the molecular formula C23H19F5N2O and a molecular weight of 434.41 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetramethyl-9-(2,3,4,5,6-pentafluorophenyl)-9H-xanthene-3,6-diamine.
| Compound Name | 3-N,3-N,6-N,6-N-tetramethyl-9-(2,3,4,5,6-pentafluorophenyl)-9H-xanthene-3,6-diamine |
|---|---|
| PubChem CID | 59705964 |
| Molecular Formula | C23H19F5N2O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetramethyl-9-(2,3,4,5,6-pentafluorophenyl)-9H-xanthene-3,6-diamine |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C2c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H19F5N2O/c1-29(2)11-5-7-13-15(9-11)31-16-10-12(30(3)4)6-8-14(16)17(13)18-19(24)21(26)23(28)22(27)20(18)25/h5-10,17H,1-4H3 |
| InChIKey | PJVIQSJYKHKPNN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|