C20H39N3 — CID 59706265
2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine (PubChem CID 59706265) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine.
| Compound Name | 2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine |
|---|---|
| PubChem CID | 59706265 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 2-methyl-1-[(9Z,12Z)-octadeca-9,12-dienyl]guanidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN/C(N)=N/C |
| InChI | InChI=1S/C20H39N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-20(21)22-2/h7-8,10-11H,3-6,9,12-19H2,1-2H3,(H3,21,22,23)/b8-7-,11-10- |
| InChIKey | DTEZKFSYLSAQJQ-NQLNTKRDSA-N |
| XLogP | 5.33 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|