About N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide
N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide (PubChem CID 59706344) has the molecular formula C23H21N3OS
and a molecular weight of 387.51 g/mol. Its IUPAC name is N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide.
Molecular Properties
| Compound Name | N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide |
| PubChem CID | 59706344 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(n1)N=C(c1ccccc1)c1ccccc1S2 |
| InChI | InChI=1S/C23H21N3OS/c1-2-3-15-24-23(27)18-13-14-20-22(25-18)26-21(16-9-5-4-6-10-16)17-11-7-8-12-19(17)28-20/h4-14H,2-3,15H2,1H3,(H,24,27) |
| InChIKey | YNICUJIEDJFDJZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide?
The IUPAC name of N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide (CID 59706344) is N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide.
What is the SMILES notation for N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide?
The canonical SMILES for N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide is CCCCNC(=O)c1ccc2c(n1)N=C(c1ccccc1)c1ccccc1S2.
What is the InChIKey of N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide?
The InChIKey is YNICUJIEDJFDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3OS/c1-2-3-15-24-23(27)18-13-14-20-22(25-18)26-21(16-9-5-4-6-10-16)17-11-7-8-12-19(17)28-20/h4-14H,2-3,15H2,1H3,(H,24,27).
What are the key properties of N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide?
N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide has a molecular weight of 387.51 g/mol, XLogP of 5.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-phenylpyrido[3,2-b][1,4]benzothiazepine-3-carboxamide is sourced from PubChem (CID 59706344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).