C28H29FN4O2 — CID 59706643
ethyl N-[(5aS,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoxalin-7-yl]carbamate (PubChem CID 59706643) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is ethyl N-[(5aS,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoxalin-7-yl]carbamate.
| Compound Name | ethyl N-[(5aS,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoxalin-7-yl]carbamate |
|---|---|
| PubChem CID | 59706643 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | ethyl N-[(5aS,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinoxalin-7-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CC[C@@H]2[C@H](Cc3nccnc3[C@H]2/C=C/c2ccc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C28H29FN4O2/c1-2-35-28(34)33-23-9-10-24-20(15-23)16-26-27(31-13-12-30-26)25(24)11-8-22-7-6-19(17-32-22)18-4-3-5-21(29)14-18/h3-8,11-14,17,20,23-25H,2,9-10,15-16H2,1H3,(H,33,34)/b11-8+/t20-,23+,24+,25-/m0/s1 |
| InChIKey | FZTSSSZFMKMKCG-QIQFPOPXSA-N |
| XLogP | 5.56 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |