C29H30FN3O2 — CID 59706699
ethyl N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinolin-7-yl]carbamate (PubChem CID 59706699) has the molecular formula C29H30FN3O2 and a molecular weight of 471.58 g/mol. Its IUPAC name is ethyl N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinolin-7-yl]carbamate.
| Compound Name | ethyl N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinolin-7-yl]carbamate |
|---|---|
| PubChem CID | 59706699 |
| Molecular Formula | C29H30FN3O2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | ethyl N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinolin-7-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CC[C@@H]2[C@H](Cc3cccnc3[C@H]2/C=C/c2ccc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C29H30FN3O2/c1-2-35-29(34)33-25-11-12-26-22(17-25)15-20-6-4-14-31-28(20)27(26)13-10-24-9-8-21(18-32-24)19-5-3-7-23(30)16-19/h3-10,13-14,16,18,22,25-27H,2,11-12,15,17H2,1H3,(H,33,34)/b13-10+/t22-,25-,26-,27+/m1/s1 |
| InChIKey | XXDVUJVBAXTRCC-QZBGFLLQSA-N |
| XLogP | 6.17 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |