About spiro[4.5]decane-6,10-dione
spiro[4.5]decane-6,10-dione (PubChem CID 597075) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is spiro[4.5]decane-6,10-dione.
Molecular Properties
| Compound Name | spiro[4.5]decane-6,10-dione |
| PubChem CID | 597075 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | spiro[4.5]decane-6,10-dione |
| SMILES | O=C1CCCC(=O)C12CCCC2 |
| InChI | InChI=1S/C10H14O2/c11-8-4-3-5-9(12)10(8)6-1-2-7-10/h1-7H2 |
| InChIKey | GAMSCVUUEKTEPL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze spiro[4.5]decane-6,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.5]decane-6,10-dione?
The IUPAC name of spiro[4.5]decane-6,10-dione (CID 597075) is spiro[4.5]decane-6,10-dione.
What is the SMILES notation for spiro[4.5]decane-6,10-dione?
The canonical SMILES for spiro[4.5]decane-6,10-dione is O=C1CCCC(=O)C12CCCC2.
What is the InChIKey of spiro[4.5]decane-6,10-dione?
The InChIKey is GAMSCVUUEKTEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c11-8-4-3-5-9(12)10(8)6-1-2-7-10/h1-7H2.
What are the key properties of spiro[4.5]decane-6,10-dione?
spiro[4.5]decane-6,10-dione has a molecular weight of 166.22 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.5]decane-6,10-dione is sourced from PubChem (CID 597075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).