About CID 59707611
CID 59707611 (PubChem CID 59707611) has the molecular formula C10H22N4O5Si2
and a molecular weight of 334.48 g/mol.
Molecular Properties
| Compound Name | CID 59707611 |
| PubChem CID | 59707611 |
| Molecular Formula | C10H22N4O5Si2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | — |
| SMILES | CO[Si]1CNC(=O)NCCCCNC(=O)NC[Si](OC)O1 |
| InChI | InChI=1S/C10H22N4O5Si2/c1-17-20-7-13-9(15)11-5-3-4-6-12-10(16)14-8-21(18-2)19-20/h3-8H2,1-2H3,(H2,11,13,15)(H2,12,14,16) |
| InChIKey | UHRZMAQVDCKCKX-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59707611 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59707611?
The IUPAC name of CID 59707611 (CID 59707611) is not available.
What is the SMILES notation for CID 59707611?
The canonical SMILES for CID 59707611 is CO[Si]1CNC(=O)NCCCCNC(=O)NC[Si](OC)O1.
What is the InChIKey of CID 59707611?
The InChIKey is UHRZMAQVDCKCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O5Si2/c1-17-20-7-13-9(15)11-5-3-4-6-12-10(16)14-8-21(18-2)19-20/h3-8H2,1-2H3,(H2,11,13,15)(H2,12,14,16).
What are the key properties of CID 59707611?
CID 59707611 has a molecular weight of 334.48 g/mol, XLogP of -1.26, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59707611 is sourced from PubChem (CID 59707611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).