About 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate
1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate (PubChem CID 59707715) has the molecular formula C18H35BrO7Si
and a molecular weight of 471.46 g/mol. Its IUPAC name is 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate.
Molecular Properties
| Compound Name | 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate |
| PubChem CID | 59707715 |
| Molecular Formula | C18H35BrO7Si |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate |
| SMILES | COCCOC(=O)CC(C)(C)CC(C)(Br)C(=O)OCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C18H35BrO7Si/c1-17(2,13-15(20)25-11-10-22-4)14-18(3,19)16(21)26-9-8-12-27(7,23-5)24-6/h8-14H2,1-7H3 |
| InChIKey | MUCJNLVRAMWWCO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate?
The IUPAC name of 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate (CID 59707715) is 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate.
What is the SMILES notation for 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate?
The canonical SMILES for 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate is COCCOC(=O)CC(C)(C)CC(C)(Br)C(=O)OCCC[Si](C)(OC)OC.
What is the InChIKey of 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate?
The InChIKey is MUCJNLVRAMWWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35BrO7Si/c1-17(2,13-15(20)25-11-10-22-4)14-18(3,19)16(21)26-9-8-12-27(7,23-5)24-6/h8-14H2,1-7H3.
What are the key properties of 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate?
1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate has a molecular weight of 471.46 g/mol, XLogP of 3.43, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-[dimethoxy(methyl)silyl]propyl] 6-O-(2-methoxyethyl) 2-bromo-2,4,4-trimethylhexanedioate is sourced from PubChem (CID 59707715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).