C25H45BrO10Si — CID 59707727
3-[4-acetyl-6-bromo-2,2,4,6-tetramethyl-7-oxo-7-(3-triethoxysilylpropoxy)heptanoyl]oxypropanoic acid (PubChem CID 59707727) has the molecular formula C25H45BrO10Si and a molecular weight of 613.62 g/mol. Its IUPAC name is 3-[4-acetyl-6-bromo-2,2,4,6-tetramethyl-7-oxo-7-(3-triethoxysilylpropoxy)heptanoyl]oxypropanoic acid.
| Compound Name | 3-[4-acetyl-6-bromo-2,2,4,6-tetramethyl-7-oxo-7-(3-triethoxysilylpropoxy)heptanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 59707727 |
| Molecular Formula | C25H45BrO10Si |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 3-[4-acetyl-6-bromo-2,2,4,6-tetramethyl-7-oxo-7-(3-triethoxysilylpropoxy)heptanoyl]oxypropanoic acid |
| SMILES | CCO[Si](CCCOC(=O)C(C)(Br)CC(C)(CC(C)(C)C(=O)OCCC(=O)O)C(C)=O)(OCC)OCC |
| InChI | InChI=1S/C25H45BrO10Si/c1-9-34-37(35-10-2,36-11-3)16-12-14-32-22(31)25(8,26)18-24(7,19(4)27)17-23(5,6)21(30)33-15-13-20(28)29/h9-18H2,1-8H3,(H,28,29) |
| InChIKey | UGOSRPNEFJMCMC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|