About 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde
4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde (PubChem CID 59707975) has the molecular formula C18H18O3S2
and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde.
Molecular Properties
| Compound Name | 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde |
| PubChem CID | 59707975 |
| Molecular Formula | C18H18O3S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde |
| SMILES | COC(OC)(C(=O)c1ccc(C=S)cc1)c1ccc(SC)cc1 |
| InChI | InChI=1S/C18H18O3S2/c1-20-18(21-2,15-8-10-16(23-3)11-9-15)17(19)14-6-4-13(12-22)5-7-14/h4-12H,1-3H3 |
| InChIKey | RDBYFDLIBIJHHJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde?
The IUPAC name of 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde (CID 59707975) is 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde.
What is the SMILES notation for 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde?
The canonical SMILES for 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde is COC(OC)(C(=O)c1ccc(C=S)cc1)c1ccc(SC)cc1.
What is the InChIKey of 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde?
The InChIKey is RDBYFDLIBIJHHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3S2/c1-20-18(21-2,15-8-10-16(23-3)11-9-15)17(19)14-6-4-13(12-22)5-7-14/h4-12H,1-3H3.
What are the key properties of 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde?
4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde has a molecular weight of 346.47 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-dimethoxy-2-(4-methylsulfanylphenyl)acetyl]thiobenzaldehyde is sourced from PubChem (CID 59707975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).