C21H18NO6W- — CID 59708121
[(2R,3R,4S)-4-benzamido-4-methanidyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate;tungsten (PubChem CID 59708121) has the molecular formula C21H18NO6W- and a molecular weight of 564.22 g/mol. Its IUPAC name is [(2R,3R,4S)-4-benzamido-4-methanidyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate;tungsten.
| Compound Name | [(2R,3R,4S)-4-benzamido-4-methanidyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate;tungsten |
|---|---|
| PubChem CID | 59708121 |
| Molecular Formula | C21H18NO6W- |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | [(2R,3R,4S)-4-benzamido-4-methanidyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate;tungsten |
| SMILES | [CH2-][C@@]1(NC(=O)c2ccccc2)C(=O)O[C@H](CC=O)[C@@H]1OC(=O)c1ccccc1.[W] |
| InChI | InChI=1S/C21H18NO6.W/c1-21(22-18(24)14-8-4-2-5-9-14)17(16(12-13-23)27-20(21)26)28-19(25)15-10-6-3-7-11-15;/h2-11,13,16-17H,1,12H2,(H,22,24);/q-1;/t16-,17+,21+;/m1./s1 |
| InChIKey | XYLOVDRSDZIEFD-POKLFOKASA-N |
| XLogP | 1.73 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|