C8H8N3Y- — CID 59708824
3,7-dimethyl-5H-imidazo[4,5-b]pyridin-5-ide;yttrium (PubChem CID 59708824) has the molecular formula C8H8N3Y- and a molecular weight of 235.08 g/mol. Its IUPAC name is 3,7-dimethyl-5H-imidazo[4,5-b]pyridin-5-ide;yttrium.
| Compound Name | 3,7-dimethyl-5H-imidazo[4,5-b]pyridin-5-ide;yttrium |
|---|---|
| PubChem CID | 59708824 |
| Molecular Formula | C8H8N3Y- |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 3,7-dimethyl-5H-imidazo[4,5-b]pyridin-5-ide;yttrium |
| SMILES | Cc1c[c-]nc2c1ncn2C.[Y] |
| InChI | InChI=1S/C8H8N3.Y/c1-6-3-4-9-8-7(6)10-5-11(8)2;/h3,5H,1-2H3;/q-1; |
| InChIKey | XGFGZDFOQXRVDC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|