C9H8N2WY-2 — CID 59708885
1,4-dimethyl-3,6-dihydropyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium (PubChem CID 59708885) has the molecular formula C9H8N2WY-2 and a molecular weight of 416.92 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-dihydropyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium.
| Compound Name | 1,4-dimethyl-3,6-dihydropyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium |
|---|---|
| PubChem CID | 59708885 |
| Molecular Formula | C9H8N2WY-2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | 1,4-dimethyl-3,6-dihydropyrrolo[2,3-b]pyridine-3,6-diide;tungsten;yttrium |
| SMILES | Cc1c[c-]nc2c1[c-]cn2C.[W].[Y] |
| InChI | InChI=1S/C9H8N2.W.Y/c1-7-3-5-10-9-8(7)4-6-11(9)2;;/h3,6H,1-2H3;;/q-2;; |
| InChIKey | OMBRRJOPVDIFCQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|