C19H22FIN8O5S — CID 59708887
3-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]propyl sulfamate (PubChem CID 59708887) has the molecular formula C19H22FIN8O5S and a molecular weight of 620.40 g/mol. Its IUPAC name is 3-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]propyl sulfamate.
| Compound Name | 3-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]propyl sulfamate |
|---|---|
| PubChem CID | 59708887 |
| Molecular Formula | C19H22FIN8O5S |
| Molecular Weight | 620.40 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 3-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]propyl sulfamate |
| SMILES | N/C(=C\NCCCOS(N)(=O)=O)Cn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C19H22FIN8O5S/c20-19-27-17(23)16-18(28-19)29(8-11(22)7-25-2-1-3-34-35(24,30)31)15(26-16)5-10-4-13-14(6-12(10)21)33-9-32-13/h4,6-7,25H,1-3,5,8-9,22H2,(H2,23,27,28)(H2,24,30,31)/b11-7- |
| InChIKey | PENZNPLOGFWSQQ-XFFZJAGNSA-N |
| XLogP | 0.47 |
| TPSA | 195.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|