C18H20FIN8O5S — CID 59708913
2-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]ethyl sulfamate (PubChem CID 59708913) has the molecular formula C18H20FIN8O5S and a molecular weight of 606.38 g/mol. Its IUPAC name is 2-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]ethyl sulfamate.
| Compound Name | 2-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]ethyl sulfamate |
|---|---|
| PubChem CID | 59708913 |
| Molecular Formula | C18H20FIN8O5S |
| Molecular Weight | 606.38 g/mol |
| Exact Mass | 606.03 |
| IUPAC Name | 2-[[(Z)-2-amino-3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]prop-1-enyl]amino]ethyl sulfamate |
| SMILES | N/C(=C\NCCOS(N)(=O)=O)Cn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C18H20FIN8O5S/c19-18-26-16(22)15-17(27-18)28(7-10(21)6-24-1-2-33-34(23,29)30)14(25-15)4-9-3-12-13(5-11(9)20)32-8-31-12/h3,5-6,24H,1-2,4,7-8,21H2,(H2,22,26,27)(H2,23,29,30)/b10-6- |
| InChIKey | RWZSZFDKUYAFCI-POHAHGRESA-N |
| XLogP | 0.08 |
| TPSA | 195.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|