About 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium
1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium (PubChem CID 59708923) has the molecular formula C10H9NWY-2
and a molecular weight of 415.94 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium.
Molecular Properties
| Compound Name | 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium |
| PubChem CID | 59708923 |
| Molecular Formula | C10H9NWY-2 |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium |
| SMILES | Cc1c[c-]cc2c1[c-]cn2C.[W].[Y] |
| InChI | InChI=1S/C10H9N.W.Y/c1-8-4-3-5-10-9(8)6-7-11(10)2;;/h4-5,7H,1-2H3;;/q-2;; |
| InChIKey | RZAMCHASOXOXOP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium?
The IUPAC name of 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium (CID 59708923) is 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium.
What is the SMILES notation for 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium?
The canonical SMILES for 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium is Cc1c[c-]cc2c1[c-]cn2C.[W].[Y].
What is the InChIKey of 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium?
The InChIKey is RZAMCHASOXOXOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.W.Y/c1-8-4-3-5-10-9(8)6-7-11(10)2;;/h4-5,7H,1-2H3;;/q-2;;.
What are the key properties of 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium?
1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium has a molecular weight of 415.94 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-3,6-dihydroindole-3,6-diide;tungsten;yttrium is sourced from PubChem (CID 59708923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).