About 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium
1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium (PubChem CID 59708934) has the molecular formula C11H12NY-
and a molecular weight of 249.14 g/mol. Its IUPAC name is 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium.
Molecular Properties
| Compound Name | 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium |
| PubChem CID | 59708934 |
| Molecular Formula | C11H12NY- |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium |
| SMILES | [3H]c1c(C)n(C)c2c[c-]cc(C)c12.[Y] |
| InChI | InChI=1S/C11H12N.Y/c1-8-5-4-6-11-10(8)7-9(2)12(11)3;/h5-7H,1-3H3;/q-1;/i7T; |
| InChIKey | CGZNVCWYGUQZAR-GSAKUAQZSA-N |
| XLogP | 2.59 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium?
The IUPAC name of 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium (CID 59708934) is 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium.
What is the SMILES notation for 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium?
The canonical SMILES for 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium is [3H]c1c(C)n(C)c2c[c-]cc(C)c12.[Y].
What is the InChIKey of 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium?
The InChIKey is CGZNVCWYGUQZAR-GSAKUAQZSA-N. The full InChI is InChI=1S/C11H12N.Y/c1-8-5-4-6-11-10(8)7-9(2)12(11)3;/h5-7H,1-3H3;/q-1;/i7T;.
What are the key properties of 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium?
1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium has a molecular weight of 249.14 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethyl-3-tritio-6H-indol-6-ide;yttrium is sourced from PubChem (CID 59708934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).