C22H30N2O6 — CID 59709141
11-(2,5-dioxopyrrol-1-yl)-8-[3-(2,5-dioxopyrrol-1-yl)propyl]undecanoic acid (PubChem CID 59709141) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 11-(2,5-dioxopyrrol-1-yl)-8-[3-(2,5-dioxopyrrol-1-yl)propyl]undecanoic acid.
| Compound Name | 11-(2,5-dioxopyrrol-1-yl)-8-[3-(2,5-dioxopyrrol-1-yl)propyl]undecanoic acid |
|---|---|
| PubChem CID | 59709141 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 11-(2,5-dioxopyrrol-1-yl)-8-[3-(2,5-dioxopyrrol-1-yl)propyl]undecanoic acid |
| SMILES | O=C(O)CCCCCCC(CCCN1C(=O)C=CC1=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H30N2O6/c25-18-11-12-19(26)23(18)15-5-8-17(7-3-1-2-4-10-22(29)30)9-6-16-24-20(27)13-14-21(24)28/h11-14,17H,1-10,15-16H2,(H,29,30) |
| InChIKey | JUDGABPSKDIHCD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|