C31H46N2O8 — CID 59709146
8,10-bis[3-(2,5-dioxopyrrol-1-yl)propyl]heptadecanedioic acid (PubChem CID 59709146) has the molecular formula C31H46N2O8 and a molecular weight of 574.72 g/mol. Its IUPAC name is 8,10-bis[3-(2,5-dioxopyrrol-1-yl)propyl]heptadecanedioic acid.
| Compound Name | 8,10-bis[3-(2,5-dioxopyrrol-1-yl)propyl]heptadecanedioic acid |
|---|---|
| PubChem CID | 59709146 |
| Molecular Formula | C31H46N2O8 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | 8,10-bis[3-(2,5-dioxopyrrol-1-yl)propyl]heptadecanedioic acid |
| SMILES | O=C(O)CCCCCCC(CCCN1C(=O)C=CC1=O)CC(CCCCCCC(=O)O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H46N2O8/c34-26-17-18-27(35)32(26)21-9-13-24(11-5-1-3-7-15-30(38)39)23-25(12-6-2-4-8-16-31(40)41)14-10-22-33-28(36)19-20-29(33)37/h17-20,24-25H,1-16,21-23H2,(H,38,39)(H,40,41) |
| InChIKey | OCWYFWZPZKXPTL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|