About 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium
2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium (PubChem CID 59709288) has the molecular formula C20H37N2+
and a molecular weight of 305.53 g/mol. Its IUPAC name is 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium.
Molecular Properties
| Compound Name | 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium |
| PubChem CID | 59709288 |
| Molecular Formula | C20H37N2+ |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.30 |
| IUPAC Name | 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium |
| SMILES | CN(CC[N+](C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H37N2/c1-19(2,3)16-11-12-18(17(15-16)20(4,5)6)21(7)13-14-22(8,9)10/h11-12,15H,13-14H2,1-10H3/q+1 |
| InChIKey | LJZADEOSZMPXTK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium?
The IUPAC name of 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium (CID 59709288) is 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium.
What is the SMILES notation for 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium?
The canonical SMILES for 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium is CN(CC[N+](C)(C)C)c1ccc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium?
The InChIKey is LJZADEOSZMPXTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37N2/c1-19(2,3)16-11-12-18(17(15-16)20(4,5)6)21(7)13-14-22(8,9)10/h11-12,15H,13-14H2,1-10H3/q+1.
What are the key properties of 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium?
2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium has a molecular weight of 305.53 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-ditert-butyl-N-methylanilino)ethyl-trimethylazanium is sourced from PubChem (CID 59709288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).