C15H10F6N2O3 — CID 59709573
3,7-diamino-9,9-bis(trifluoromethyl)xanthene-2,6-diol (PubChem CID 59709573) has the molecular formula C15H10F6N2O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is 3,7-diamino-9,9-bis(trifluoromethyl)xanthene-2,6-diol.
| Compound Name | 3,7-diamino-9,9-bis(trifluoromethyl)xanthene-2,6-diol |
|---|---|
| PubChem CID | 59709573 |
| Molecular Formula | C15H10F6N2O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3,7-diamino-9,9-bis(trifluoromethyl)xanthene-2,6-diol |
| SMILES | Nc1cc2c(cc1O)Oc1cc(N)c(O)cc1C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H10F6N2O3/c16-14(17,18)13(15(19,20)21)5-1-7(22)10(25)4-12(5)26-11-3-8(23)9(24)2-6(11)13/h1-4,24-25H,22-23H2 |
| InChIKey | IQSZSKJPJZOTEU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|