About N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide
N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide (PubChem CID 59710509) has the molecular formula C16H16N4O4S
and a molecular weight of 360.40 g/mol. Its IUPAC name is N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide.
Molecular Properties
| Compound Name | N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide |
| PubChem CID | 59710509 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide |
| SMILES | C[C@@H](NS(=O)c1ccc(Oc2ccccn2)cc1)[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C16H16N4O4S/c1-10(14-15(21)19-16(22)18-14)20-25(23)12-7-5-11(6-8-12)24-13-4-2-3-9-17-13/h2-10,14,20H,1H3,(H2,18,19,21,22)/t10-,14+,25?/m1/s1 |
| InChIKey | DUXBUZMPOBDUEE-YSWOESNESA-N |
| XLogP | 1.08 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide?
The IUPAC name of N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide (CID 59710509) is N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide.
What is the SMILES notation for N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide?
The canonical SMILES for N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide is C[C@@H](NS(=O)c1ccc(Oc2ccccn2)cc1)[C@@H]1NC(=O)NC1=O.
What is the InChIKey of N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide?
The InChIKey is DUXBUZMPOBDUEE-YSWOESNESA-N. The full InChI is InChI=1S/C16H16N4O4S/c1-10(14-15(21)19-16(22)18-14)20-25(23)12-7-5-11(6-8-12)24-13-4-2-3-9-17-13/h2-10,14,20H,1H3,(H2,18,19,21,22)/t10-,14+,25?/m1/s1.
What are the key properties of N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide?
N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide has a molecular weight of 360.40 g/mol, XLogP of 1.08, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-[(4S)-2,5-dioxoimidazolidin-4-yl]ethyl]-4-pyridin-2-yloxybenzenesulfinamide is sourced from PubChem (CID 59710509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).