About 4-phenyliodanuidylphenol
4-phenyliodanuidylphenol (PubChem CID 59710705) has the molecular formula C12H10IO-
and a molecular weight of 297.12 g/mol. Its IUPAC name is 4-phenyliodanuidylphenol.
Molecular Properties
| Compound Name | 4-phenyliodanuidylphenol |
| PubChem CID | 59710705 |
| Molecular Formula | C12H10IO- |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 4-phenyliodanuidylphenol |
| SMILES | Oc1ccc([I-]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10IO/c14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,14H/q-1 |
| InChIKey | YMRNJKBNTGPUSQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyliodanuidylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyliodanuidylphenol?
The IUPAC name of 4-phenyliodanuidylphenol (CID 59710705) is 4-phenyliodanuidylphenol.
What is the SMILES notation for 4-phenyliodanuidylphenol?
The canonical SMILES for 4-phenyliodanuidylphenol is Oc1ccc([I-]c2ccccc2)cc1.
What is the InChIKey of 4-phenyliodanuidylphenol?
The InChIKey is YMRNJKBNTGPUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10IO/c14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,14H/q-1.
What are the key properties of 4-phenyliodanuidylphenol?
4-phenyliodanuidylphenol has a molecular weight of 297.12 g/mol, XLogP of -0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyliodanuidylphenol is sourced from PubChem (CID 59710705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).