C10N4O2 — CID 59711136
4,5-diisocyano-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 59711136) has the molecular formula C10N4O2 and a molecular weight of 208.14 g/mol. Its IUPAC name is 4,5-diisocyano-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | 4,5-diisocyano-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 59711136 |
| Molecular Formula | C10N4O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 4,5-diisocyano-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]C1=C([N+]#[C-])C(=O)C(C#N)=C(C#N)C1=O |
| InChI | InChI=1S/C10N4O2/c1-13-7-8(14-2)10(16)6(4-12)5(3-11)9(7)15 |
| InChIKey | LHVHEPNJKFJIFO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|