C17H20F3N6O2S2- — CID 59711181
[2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]-5-(1,4,5-trimethylpyrrolidin-3-yl)phenyl]-(trifluoromethylsulfonyl)azanide (PubChem CID 59711181) has the molecular formula C17H20F3N6O2S2- and a molecular weight of 461.52 g/mol. Its IUPAC name is [2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]-5-(1,4,5-trimethylpyrrolidin-3-yl)phenyl]-(trifluoromethylsulfonyl)azanide.
| Compound Name | [2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]-5-(1,4,5-trimethylpyrrolidin-3-yl)phenyl]-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 59711181 |
| Molecular Formula | C17H20F3N6O2S2- |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [2-[(5-methyl-1,3,4-thiadiazol-2-yl)diazenyl]-5-(1,4,5-trimethylpyrrolidin-3-yl)phenyl]-(trifluoromethylsulfonyl)azanide |
| SMILES | Cc1nnc(/N=N/c2ccc(C3CN(C)C(C)C3C)cc2[N-]S(=O)(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C17H20F3N6O2S2/c1-9-10(2)26(4)8-13(9)12-5-6-14(22-24-16-23-21-11(3)29-16)15(7-12)25-30(27,28)17(18,19)20/h5-7,9-10,13H,8H2,1-4H3/q-1/b24-22+ |
| InChIKey | AGSVRGZAARNQLS-ZNTNEXAZSA-N |
| XLogP | 5.17 |
| TPSA | 101.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|