C16H22O9 — CID 59711372
(2,3-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate (PubChem CID 59711372) has the molecular formula C16H22O9 and a molecular weight of 358.34 g/mol. Its IUPAC name is (2,3-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate.
| Compound Name | (2,3-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59711372 |
| Molecular Formula | C16H22O9 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2,3-diacetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C(OC(C)=O)C(OC(C)=O)OC12 |
| InChI | InChI=1S/C16H22O9/c1-6-16(4,5)15(20)25-11-9-10(23-13(11)19)12(21-7(2)17)14(24-9)22-8(3)18/h9-12,14H,6H2,1-5H3 |
| InChIKey | DWEPZMWBXUHMMX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|