C12H14O7 — CID 59711393
(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) prop-2-enoate (PubChem CID 59711393) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) prop-2-enoate.
| Compound Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) prop-2-enoate |
|---|---|
| PubChem CID | 59711393 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C12H14O7/c1-4-5(13)15-8-6-7(16-10(8)14)9-11(17-6)19-12(2,3)18-9/h4,6-9,11H,1H2,2-3H3 |
| InChIKey | MCXWLMPKGFORCG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|