C13H18O4 — CID 59711406
[(3R,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]methyl 2-methylbutanoate (PubChem CID 59711406) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is [(3R,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]methyl 2-methylbutanoate.
| Compound Name | [(3R,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59711406 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [(3R,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC[C@@H]1C(=O)O[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C13H18O4/c1-3-8(2)12(14)16-7-10-9-5-4-6-11(9)17-13(10)15/h4,6,8-11H,3,5,7H2,1-2H3/t8?,9-,10+,11-/m1/s1 |
| InChIKey | SIPCSCBZVIQKHD-HUAZRZQGSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|