C20H24O4 — CID 59711456
(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 59711456) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 59711456 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C(OC1C(=O)OC2CCCC21)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C20H24O4/c21-19(24-18-12-2-1-3-15(12)23-20(18)22)14-8-11-7-13(14)17-10-5-4-9(6-10)16(11)17/h4-5,9-18H,1-3,6-8H2 |
| InChIKey | FXHMVBGIWAMZSQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|