C13H18O5 — CID 59711464
(2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2-(hydroxymethyl)-2-methylbutanoate (PubChem CID 59711464) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2-(hydroxymethyl)-2-methylbutanoate.
| Compound Name | (2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2-(hydroxymethyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 59711464 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2-(hydroxymethyl)-2-methylbutanoate |
| SMILES | CCC(C)(CO)C(=O)OC1C(=O)OC2C=CCC21 |
| InChI | InChI=1S/C13H18O5/c1-3-13(2,7-14)12(16)18-10-8-5-4-6-9(8)17-11(10)15/h4,6,8-10,14H,3,5,7H2,1-2H3 |
| InChIKey | WTFOGKQRGCJQFF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|