C13H18O4 — CID 59711467
(2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate (PubChem CID 59711467) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate.
| Compound Name | (2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59711467 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C=CCC21 |
| InChI | InChI=1S/C13H18O4/c1-4-13(2,3)12(15)17-10-8-6-5-7-9(8)16-11(10)14/h5,7-10H,4,6H2,1-3H3 |
| InChIKey | JGBFXSLDWYXCKM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|