C14H22O7 — CID 59711497
(2,3-dimethoxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate (PubChem CID 59711497) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is (2,3-dimethoxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate.
| Compound Name | (2,3-dimethoxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59711497 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2,3-dimethoxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C(OC)C(OC)OC12 |
| InChI | InChI=1S/C14H22O7/c1-6-14(2,3)13(16)21-9-7-8(19-11(9)15)10(17-4)12(18-5)20-7/h7-10,12H,6H2,1-5H3 |
| InChIKey | KJKYHTRUJDZHRW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |