About cis-(1S,2R)-1,2-ditert-butylcyclohexane
cis-(1S,2R)-1,2-ditert-butylcyclohexane (PubChem CID 59711734) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is cis-(1S,2R)-1,2-ditert-butylcyclohexane.
Molecular Properties
| Compound Name | cis-(1S,2R)-1,2-ditert-butylcyclohexane |
| PubChem CID | 59711734 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | cis-(1S,2R)-1,2-ditert-butylcyclohexane |
| SMILES | CC(C)(C)[C@@H]1CCCC[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C14H28/c1-13(2,3)11-9-7-8-10-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3/t11-,12+ |
| InChIKey | FPPQKYTWISSUGQ-TXEJJXNPSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cis-(1S,2R)-1,2-ditert-butylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-1,2-ditert-butylcyclohexane?
The IUPAC name of cis-(1S,2R)-1,2-ditert-butylcyclohexane (CID 59711734) is cis-(1S,2R)-1,2-ditert-butylcyclohexane.
What is the SMILES notation for cis-(1S,2R)-1,2-ditert-butylcyclohexane?
The canonical SMILES for cis-(1S,2R)-1,2-ditert-butylcyclohexane is CC(C)(C)[C@@H]1CCCC[C@@H]1C(C)(C)C.
What is the InChIKey of cis-(1S,2R)-1,2-ditert-butylcyclohexane?
The InChIKey is FPPQKYTWISSUGQ-TXEJJXNPSA-N. The full InChI is InChI=1S/C14H28/c1-13(2,3)11-9-7-8-10-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3/t11-,12+.
What are the key properties of cis-(1S,2R)-1,2-ditert-butylcyclohexane?
cis-(1S,2R)-1,2-ditert-butylcyclohexane has a molecular weight of 196.38 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-1,2-ditert-butylcyclohexane is sourced from PubChem (CID 59711734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).