C24H29NO7 — CID 59712310
2-[[4-ethoxy-3-[(4-ethoxyphenyl)carbamoyloxymethyl]phenyl]methyl]oxolane-2-carboxylic acid (PubChem CID 59712310) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[[4-ethoxy-3-[(4-ethoxyphenyl)carbamoyloxymethyl]phenyl]methyl]oxolane-2-carboxylic acid.
| Compound Name | 2-[[4-ethoxy-3-[(4-ethoxyphenyl)carbamoyloxymethyl]phenyl]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 59712310 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[[4-ethoxy-3-[(4-ethoxyphenyl)carbamoyloxymethyl]phenyl]methyl]oxolane-2-carboxylic acid |
| SMILES | CCOc1ccc(NC(=O)OCc2cc(CC3(C(=O)O)CCCO3)ccc2OCC)cc1 |
| InChI | InChI=1S/C24H29NO7/c1-3-29-20-9-7-19(8-10-20)25-23(28)31-16-18-14-17(6-11-21(18)30-4-2)15-24(22(26)27)12-5-13-32-24/h6-11,14H,3-5,12-13,15-16H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | UWMFPMDKGXSUCD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |