About CID 59712567
CID 59712567 (PubChem CID 59712567) has the molecular formula C21H32N2O4
and a molecular weight of 376.50 g/mol.
Molecular Properties
| Compound Name | CID 59712567 |
| PubChem CID | 59712567 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | — |
| SMILES | NC(=O)CCNCC1CCC2(CC1)OOC1(O2)C2CC3CC4CC1CC34C2 |
| InChI | InChI=1S/C21H32N2O4/c22-18(24)3-6-23-12-13-1-4-20(5-2-13)25-21(27-26-20)16-8-14-7-15-9-17(21)11-19(14,15)10-16/h13-17,23H,1-12H2,(H2,22,24) |
| InChIKey | UBFVYMLOORCXOD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 59712567 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59712567?
The IUPAC name of CID 59712567 (CID 59712567) is not available.
What is the SMILES notation for CID 59712567?
The canonical SMILES for CID 59712567 is NC(=O)CCNCC1CCC2(CC1)OOC1(O2)C2CC3CC4CC1CC34C2.
What is the InChIKey of CID 59712567?
The InChIKey is UBFVYMLOORCXOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O4/c22-18(24)3-6-23-12-13-1-4-20(5-2-13)25-21(27-26-20)16-8-14-7-15-9-17(21)11-19(14,15)10-16/h13-17,23H,1-12H2,(H2,22,24).
What are the key properties of CID 59712567?
CID 59712567 has a molecular weight of 376.50 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59712567 is sourced from PubChem (CID 59712567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).