About 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol
4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol (PubChem CID 59712642) has the molecular formula C21H28O3
and a molecular weight of 328.45 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol |
| PubChem CID | 59712642 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol |
| SMILES | Cc1ccc(COOCc2cc(C(C)C)c(O)c(C(C)C)c2)cc1 |
| InChI | InChI=1S/C21H28O3/c1-14(2)19-10-18(11-20(15(3)4)21(19)22)13-24-23-12-17-8-6-16(5)7-9-17/h6-11,14-15,22H,12-13H2,1-5H3 |
| InChIKey | NGYFCZHKPSYEPB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol?
The IUPAC name of 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol (CID 59712642) is 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol.
What is the SMILES notation for 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol?
The canonical SMILES for 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol is Cc1ccc(COOCc2cc(C(C)C)c(O)c(C(C)C)c2)cc1.
What is the InChIKey of 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol?
The InChIKey is NGYFCZHKPSYEPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O3/c1-14(2)19-10-18(11-20(15(3)4)21(19)22)13-24-23-12-17-8-6-16(5)7-9-17/h6-11,14-15,22H,12-13H2,1-5H3.
What are the key properties of 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol?
4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol has a molecular weight of 328.45 g/mol, XLogP of 5.60, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methylphenyl)methylperoxymethyl]-2,6-di(propan-2-yl)phenol is sourced from PubChem (CID 59712642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).