About 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile
6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile (PubChem CID 59712739) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile |
| PubChem CID | 59712739 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CNCCCn1c(O)c(C)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C12H17N3O2/c1-8-9(2)11(16)15(6-4-5-14-3)12(17)10(8)7-13/h14,16H,4-6H2,1-3H3 |
| InChIKey | KLFJTLZGPAHQRZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile?
The IUPAC name of 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile (CID 59712739) is 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile.
What is the SMILES notation for 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile?
The canonical SMILES for 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile is CNCCCn1c(O)c(C)c(C)c(C#N)c1=O.
What is the InChIKey of 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile?
The InChIKey is KLFJTLZGPAHQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-8-9(2)11(16)15(6-4-5-14-3)12(17)10(8)7-13/h14,16H,4-6H2,1-3H3.
What are the key properties of 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile?
6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile has a molecular weight of 235.29 g/mol, XLogP of 0.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4,5-dimethyl-1-[3-(methylamino)propyl]-2-oxopyridine-3-carbonitrile is sourced from PubChem (CID 59712739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).