C23H30N2O9S — CID 59712871
dimethyl (1R,4S,5S,6S)-4-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2,2-dioxo-2λ6-thiabicyclo[3.1.0]hexane-4,6-dicarboxylate (PubChem CID 59712871) has the molecular formula C23H30N2O9S and a molecular weight of 510.57 g/mol. Its IUPAC name is dimethyl (1R,4S,5S,6S)-4-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2,2-dioxo-2λ6-thiabicyclo[3.1.0]hexane-4,6-dicarboxylate.
| Compound Name | dimethyl (1R,4S,5S,6S)-4-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2,2-dioxo-2λ6-thiabicyclo[3.1.0]hexane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 59712871 |
| Molecular Formula | C23H30N2O9S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | dimethyl (1R,4S,5S,6S)-4-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-2,2-dioxo-2λ6-thiabicyclo[3.1.0]hexane-4,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H]1S(=O)(=O)C[C@@]2(NC(=O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C23H30N2O9S/c1-22(2,3)34-21(29)24-14(11-13-9-7-6-8-10-13)18(26)25-23(20(28)33-5)12-35(30,31)17-15(16(17)23)19(27)32-4/h6-10,14-17H,11-12H2,1-5H3,(H,24,29)(H,25,26)/t14-,15-,16-,17+,23+/m1/s1 |
| InChIKey | FVQSIAKZMSTNRD-XKLUSODASA-N |
| XLogP | 0.37 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|