C4H5F6NO2S — CID 59713180
1,1,2,2,2-pentafluoro-N-(2-fluoroethyl)ethanesulfonamide (PubChem CID 59713180) has the molecular formula C4H5F6NO2S and a molecular weight of 245.14 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoro-N-(2-fluoroethyl)ethanesulfonamide.
| Compound Name | 1,1,2,2,2-pentafluoro-N-(2-fluoroethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 59713180 |
| Molecular Formula | C4H5F6NO2S |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 1,1,2,2,2-pentafluoro-N-(2-fluoroethyl)ethanesulfonamide |
| SMILES | O=S(=O)(NCCF)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H5F6NO2S/c5-1-2-11-14(12,13)4(9,10)3(6,7)8/h11H,1-2H2 |
| InChIKey | KFRMPAHTEVKLDK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|