About 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate
3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate (PubChem CID 59713201) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate.
Molecular Properties
| Compound Name | 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate |
| PubChem CID | 59713201 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate |
| SMILES | C=CC(=O)OCCCOC(=O)C(CC)(CO)CO |
| InChI | InChI=1S/C12H20O6/c1-3-10(15)17-6-5-7-18-11(16)12(4-2,8-13)9-14/h3,13-14H,1,4-9H2,2H3 |
| InChIKey | INRABGMOFNZEHL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate?
The IUPAC name of 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate (CID 59713201) is 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate.
What is the SMILES notation for 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate?
The canonical SMILES for 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate is C=CC(=O)OCCCOC(=O)C(CC)(CO)CO.
What is the InChIKey of 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate?
The InChIKey is INRABGMOFNZEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-3-10(15)17-6-5-7-18-11(16)12(4-2,8-13)9-14/h3,13-14H,1,4-9H2,2H3.
What are the key properties of 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate?
3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate has a molecular weight of 260.29 g/mol, XLogP of 0.03, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoyloxypropyl 2,2-bis(hydroxymethyl)butanoate is sourced from PubChem (CID 59713201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).