C30H40O3 — CID 59713312
(3E,5E,7E,9E,12E,18E,20E,22E,24E,26E)-15,17-dihydroxy-14,16-dimethyloctacosa-3,5,7,9,12,18,20,22,24,26-decaen-2-one (PubChem CID 59713312) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is (3E,5E,7E,9E,12E,18E,20E,22E,24E,26E)-15,17-dihydroxy-14,16-dimethyloctacosa-3,5,7,9,12,18,20,22,24,26-decaen-2-one.
| Compound Name | (3E,5E,7E,9E,12E,18E,20E,22E,24E,26E)-15,17-dihydroxy-14,16-dimethyloctacosa-3,5,7,9,12,18,20,22,24,26-decaen-2-one |
|---|---|
| PubChem CID | 59713312 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3E,5E,7E,9E,12E,18E,20E,22E,24E,26E)-15,17-dihydroxy-14,16-dimethyloctacosa-3,5,7,9,12,18,20,22,24,26-decaen-2-one |
| SMILES | C/C=C/C=C/C=C/C=C/C=C/C(O)C(C)C(O)C(C)/C=C/C/C=C/C=C/C=C/C=C/C(C)=O |
| InChI | InChI=1S/C30H40O3/c1-5-6-7-8-9-11-16-19-22-25-29(32)28(4)30(33)26(2)23-20-17-14-12-10-13-15-18-21-24-27(3)31/h5-16,18-26,28-30,32-33H,17H2,1-4H3/b6-5+,8-7+,11-9+,13-10+,14-12+,18-15+,19-16+,23-20+,24-21+,25-22+ |
| InChIKey | XSHHGBWTXGPQFX-NKKUSKPHSA-N |
| XLogP | 6.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|