C22H26ClN5OS — CID 59713989
1-(3-amino-2,2-dimethylpropyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 59713989) has the molecular formula C22H26ClN5OS and a molecular weight of 444.00 g/mol. Its IUPAC name is 1-(3-amino-2,2-dimethylpropyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-(3-amino-2,2-dimethylpropyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 59713989 |
| Molecular Formula | C22H26ClN5OS |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 1-(3-amino-2,2-dimethylpropyl)-3-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NCC(C)(C)CN)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H26ClN5OS/c1-22(2,12-24)13-25-21(30)27-19-20(29)28(3)17-10-9-15(23)11-16(17)18(26-19)14-7-5-4-6-8-14/h4-11,19H,12-13,24H2,1-3H3,(H2,25,27,30) |
| InChIKey | ZQOIPFORNBYDHM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|