C21H19ClN4OS — CID 59714336
N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,5-dihydropyrrole-1-carbothioamide (PubChem CID 59714336) has the molecular formula C21H19ClN4OS and a molecular weight of 410.93 g/mol. Its IUPAC name is N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,5-dihydropyrrole-1-carbothioamide.
| Compound Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,5-dihydropyrrole-1-carbothioamide |
|---|---|
| PubChem CID | 59714336 |
| Molecular Formula | C21H19ClN4OS |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2,5-dihydropyrrole-1-carbothioamide |
| SMILES | CN1C(=O)C(NC(=S)N2CC=CC2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H19ClN4OS/c1-25-17-10-9-15(22)13-16(17)18(14-7-3-2-4-8-14)23-19(20(25)27)24-21(28)26-11-5-6-12-26/h2-10,13,19H,11-12H2,1H3,(H,24,28) |
| InChIKey | DGOWYUHZHKCTAS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|