C26H23ClN4OS — CID 59714459
1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(2,3-dihydro-1H-inden-2-yl)thiourea (PubChem CID 59714459) has the molecular formula C26H23ClN4OS and a molecular weight of 475.02 g/mol. Its IUPAC name is 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(2,3-dihydro-1H-inden-2-yl)thiourea.
| Compound Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(2,3-dihydro-1H-inden-2-yl)thiourea |
|---|---|
| PubChem CID | 59714459 |
| Molecular Formula | C26H23ClN4OS |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 1-(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-3-(2,3-dihydro-1H-inden-2-yl)thiourea |
| SMILES | CN1C(=O)C(NC(=S)NC2Cc3ccccc3C2)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H23ClN4OS/c1-31-22-12-11-19(27)15-21(22)23(16-7-3-2-4-8-16)29-24(25(31)32)30-26(33)28-20-13-17-9-5-6-10-18(17)14-20/h2-12,15,20,24H,13-14H2,1H3,(H2,28,30,33) |
| InChIKey | CLVWBPSCYBYPFH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|