C27H47ClN8O8 — CID 59714714
3,5-diamino-N-[N'-[7-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]heptyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 59714714) has the molecular formula C27H47ClN8O8 and a molecular weight of 647.17 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[7-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]heptyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[7-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]heptyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59714714 |
| Molecular Formula | C27H47ClN8O8 |
| Molecular Weight | 647.17 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | 3,5-diamino-N-[N'-[7-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]heptyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | C[C@@H]1OC[C@@H](O)[C@H](CN(CCOCCCCCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)C[C@@H]2O[C@H](C)OC[C@H]2O)O1 |
| InChI | InChI=1S/C27H47ClN8O8/c1-16-41-14-18(37)20(43-16)12-36(13-21-19(38)15-42-17(2)44-21)9-11-40-10-7-5-3-4-6-8-32-27(31)35-26(39)22-24(29)34-25(30)23(28)33-22/h16-21,37-38H,3-15H2,1-2H3,(H4,29,30,34)(H3,31,32,35,39)/t16-,17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | LKUVMDULHFZCEX-SOXBMFEASA-N |
| XLogP | -0.15 |
| TPSA | 235.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|