C20H34ClN7O6 — CID 59714723
3,5-diamino-6-chloro-N-[N'-[6-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]hexyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 59714723) has the molecular formula C20H34ClN7O6 and a molecular weight of 503.99 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[6-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]hexyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[6-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]hexyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59714723 |
| Molecular Formula | C20H34ClN7O6 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[6-[(2R)-2-hydroxy-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]hexyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC1(C)O[C@H]([C@H](O)COCCCCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)[C@H](CO)O1 |
| InChI | InChI=1S/C20H34ClN7O6/c1-20(2)33-12(9-29)14(34-20)11(30)10-32-8-6-4-3-5-7-25-19(24)28-18(31)13-16(22)27-17(23)15(21)26-13/h11-12,14,29-30H,3-10H2,1-2H3,(H4,22,23,27)(H3,24,25,28,31)/t11-,12+,14-/m1/s1 |
| InChIKey | VWJAKAISSHFNKI-MBNYWOFBSA-N |
| XLogP | -0.21 |
| TPSA | 213.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|