C21H34N2O2 — CID 59715001
2-[4-[2-[4-(4-methylanilino)piperidin-1-yl]ethyl]oxan-4-yl]ethanol (PubChem CID 59715001) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2-[4-[2-[4-(4-methylanilino)piperidin-1-yl]ethyl]oxan-4-yl]ethanol.
| Compound Name | 2-[4-[2-[4-(4-methylanilino)piperidin-1-yl]ethyl]oxan-4-yl]ethanol |
|---|---|
| PubChem CID | 59715001 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 2-[4-[2-[4-(4-methylanilino)piperidin-1-yl]ethyl]oxan-4-yl]ethanol |
| SMILES | Cc1ccc(NC2CCN(CCC3(CCO)CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C21H34N2O2/c1-18-2-4-19(5-3-18)22-20-6-12-23(13-7-20)14-8-21(9-15-24)10-16-25-17-11-21/h2-5,20,22,24H,6-17H2,1H3 |
| InChIKey | CBRPJSOFUGFBGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |