C20H34O — CID 597151
5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,2'-oxolane] (PubChem CID 597151) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,2'-oxolane].
| Compound Name | 5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,2'-oxolane] |
|---|---|
| PubChem CID | 597151 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 5'-ethyl-4,4,5',7,8a-pentamethylspiro[2,3,4a,5-tetrahydro-1H-naphthalene-8,2'-oxolane] |
| SMILES | CCC1(C)CCC2(O1)C(C)=CCC1C(C)(C)CCCC12C |
| InChI | InChI=1S/C20H34O/c1-7-18(5)13-14-20(21-18)15(2)9-10-16-17(3,4)11-8-12-19(16,20)6/h9,16H,7-8,10-14H2,1-6H3 |
| InChIKey | OVXBXSBTXMSYKL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|