C20H14Cl2N6O2 — CID 59715452
(6S,7aS)-6-azido-2-(3,5-dichlorophenyl)-7a-[(4-isocyanophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 59715452) has the molecular formula C20H14Cl2N6O2 and a molecular weight of 441.28 g/mol. Its IUPAC name is (6S,7aS)-6-azido-2-(3,5-dichlorophenyl)-7a-[(4-isocyanophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6S,7aS)-6-azido-2-(3,5-dichlorophenyl)-7a-[(4-isocyanophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 59715452 |
| Molecular Formula | C20H14Cl2N6O2 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | (6S,7aS)-6-azido-2-(3,5-dichlorophenyl)-7a-[(4-isocyanophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(C[C@@]23C[C@H](N=[N+]=[N-])CN2C(=O)N(c2cc(Cl)cc(Cl)c2)C3=O)cc1 |
| InChI | InChI=1S/C20H14Cl2N6O2/c1-24-15-4-2-12(3-5-15)9-20-10-16(25-26-23)11-27(20)19(30)28(18(20)29)17-7-13(21)6-14(22)8-17/h2-8,16H,9-11H2/t16-,20-/m0/s1 |
| InChIKey | UPEHKUFSZVIZMW-JXFKEZNVSA-N |
| XLogP | 5.38 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|